mirror of
https://github.com/scsibug/nostr-rs-relay.git
synced 2024-06-02 18:14:08 -04:00
Compare commits
30 Commits
Author | SHA1 | Date | |
---|---|---|---|
|
b04ab76e73 | ||
|
39a3a258a0 | ||
|
44c6e3d88b | ||
|
767b76b2b3 | ||
|
c5fb16cd98 | ||
|
9c86f03902 | ||
|
971889f9a6 | ||
|
388eadf880 | ||
|
1ce029860c | ||
|
b7e10e26a2 | ||
|
ab736f5f98 | ||
|
b4471a6698 | ||
|
7120de4ff8 | ||
|
4ff77ab537 | ||
|
84f60f0abc | ||
|
8a67770206 | ||
|
7650f5f4a3 | ||
|
a7b169c0d3 | ||
|
24b1705a08 | ||
|
9d0a98f8bf | ||
|
26f296f76f | ||
|
c3c9b5dcd2 | ||
|
da29bdd837 | ||
|
bacb85024c | ||
|
7a77c459bb | ||
|
34c8b04926 | ||
|
1032a51220 | ||
|
79abd981e1 | ||
|
b1957ab2b1 | ||
|
23aa6e7313 |
1510
Cargo.lock
generated
1510
Cargo.lock
generated
File diff suppressed because it is too large
Load Diff
|
@ -1,6 +1,6 @@
|
|||
[package]
|
||||
name = "nostr-rs-relay"
|
||||
version = "0.8.12"
|
||||
version = "0.8.13"
|
||||
edition = "2021"
|
||||
authors = ["Greg Heartsfield <scsibug@imap.cc>"]
|
||||
description = "A relay implementation for the Nostr protocol"
|
||||
|
@ -39,7 +39,7 @@ lazy_static = "1.4"
|
|||
governor = "0.4"
|
||||
nonzero_ext = "0.3"
|
||||
hyper = { version="0.14", features=["client", "server","http1","http2","tcp"] }
|
||||
hyper-tls = "0.5"
|
||||
hyper-rustls = { version = "0.24" }
|
||||
http = { version = "0.2" }
|
||||
parse_duration = "2"
|
||||
rand = "0.8"
|
||||
|
|
|
@ -49,7 +49,7 @@ The examples below start a rootless podman container, mapping a local
|
|||
data directory and config file.
|
||||
|
||||
```console
|
||||
$ podman build -t nostr-rs-relay .
|
||||
$ podman build --pull -t nostr-rs-relay .
|
||||
|
||||
$ mkdir data
|
||||
|
||||
|
|
18
config.toml
18
config.toml
|
@ -10,7 +10,7 @@ name = "nostr-rs-relay"
|
|||
# Description
|
||||
description = "A newly created nostr-rs-relay.\n\nCustomize this with your own info."
|
||||
|
||||
# Administrative contact pubkey
|
||||
# Administrative contact pubkey (32-byte hex, not npub)
|
||||
#pubkey = "0c2d168a4ae8ca58c9f1ab237b5df682599c6c7ab74307ea8b05684b60405d41"
|
||||
|
||||
# Administrative contact URI
|
||||
|
@ -40,7 +40,7 @@ description = "A newly created nostr-rs-relay.\n\nCustomize this with your own i
|
|||
# Use an in-memory database instead of 'nostr.db'.
|
||||
# Requires sqlite engine.
|
||||
# Caution; this will not survive a process restart!
|
||||
#in_memory = true
|
||||
#in_memory = false
|
||||
|
||||
# Database connection pool settings for subscribers:
|
||||
|
||||
|
@ -75,6 +75,11 @@ description = "A newly created nostr-rs-relay.\n\nCustomize this with your own i
|
|||
# `proto/nauthz.proto`.
|
||||
# event_admission_server = "http://[::1]:50051"
|
||||
|
||||
# If the event admission server denies writes
|
||||
# in any case (excluding spam filtering).
|
||||
# This is reflected in the relay information document.
|
||||
# restricts_write = true
|
||||
|
||||
[network]
|
||||
# Bind to this network address
|
||||
address = "0.0.0.0"
|
||||
|
@ -150,6 +155,11 @@ reject_future_seconds = 1800
|
|||
# 0, 1, 2, 3, 7, 40, 41, 42, 43, 44, 30023,
|
||||
#]
|
||||
|
||||
# Rejects imprecise requests (kind only and author only etc)
|
||||
# This is a temperary measure to improve the adoption of outbox model
|
||||
# Its recommended to have this enabled
|
||||
limit_scrapers = false
|
||||
|
||||
[authorization]
|
||||
# Pubkey addresses in this array are whitelisted for event publishing.
|
||||
# Only valid events by these authors will be accepted, if the variable
|
||||
|
@ -160,7 +170,7 @@ reject_future_seconds = 1800
|
|||
#]
|
||||
# Enable NIP-42 authentication
|
||||
#nip42_auth = false
|
||||
# Send DMs events (kind 4) only to their authenticated recipients
|
||||
# Send DMs (kind 4 and 44) and gift wraps (kind 1059) only to their authenticated recipients
|
||||
#nip42_dms = false
|
||||
|
||||
[verified_users]
|
||||
|
@ -206,7 +216,7 @@ reject_future_seconds = 1800
|
|||
#api_secret = "<ln bits api>"
|
||||
|
||||
# Nostr direct message on signup
|
||||
#direct_message=true
|
||||
#direct_message=false
|
||||
|
||||
# Terms of service
|
||||
#terms_message = """
|
||||
|
|
|
@ -30,7 +30,8 @@ To get the service running, we need to reload the systemd daemon and enable the
|
|||
|
||||
1. `sudo systemctl daemon-reload`
|
||||
2. `sudo systemctl start nostr-rs-relay.service`
|
||||
3. `sudo systemctl status nostr-rs-relay.service`
|
||||
3. `sudo systemctl enable nostr-rs-relay.service`
|
||||
4. `sudo systemctl status nostr-rs-relay.service`
|
||||
|
||||
|
||||
### Tips
|
||||
|
|
|
@ -1,6 +1,6 @@
|
|||
fn main() -> Result<(), Box<dyn std::error::Error>> {
|
||||
tonic_build::configure()
|
||||
.build_server(false)
|
||||
.build_server(true)
|
||||
.protoc_arg("--experimental_allow_proto3_optional")
|
||||
.compile(&["../../proto/nauthz.proto"], &["../../proto"])?;
|
||||
Ok(())
|
||||
|
|
|
@ -143,7 +143,7 @@ fn write_event(tx: &Transaction, e: Event) -> Result<usize> {
|
|||
let event_id = tx.last_insert_rowid();
|
||||
// look at each event, and each tag, creating new tag entries if appropriate.
|
||||
for t in e.tags.iter().filter(|x| x.len() > 1) {
|
||||
let tagname = t.get(0).unwrap();
|
||||
let tagname = t.first().unwrap();
|
||||
let tagnamechar_opt = single_char_tagname(tagname);
|
||||
if tagnamechar_opt.is_none() {
|
||||
continue;
|
||||
|
|
|
@ -32,6 +32,7 @@ pub struct Database {
|
|||
#[allow(unused)]
|
||||
pub struct Grpc {
|
||||
pub event_admission_server: Option<String>,
|
||||
pub restricts_write: bool,
|
||||
}
|
||||
|
||||
#[derive(Debug, Clone, Serialize, Deserialize)]
|
||||
|
@ -73,6 +74,7 @@ pub struct Limits {
|
|||
pub event_persist_buffer: usize, // events to buffer for database commits (block senders if database writes are too slow)
|
||||
pub event_kind_blacklist: Option<Vec<u64>>,
|
||||
pub event_kind_allowlist: Option<Vec<u64>>,
|
||||
pub limit_scrapers: bool,
|
||||
}
|
||||
|
||||
#[derive(Debug, Clone, Serialize, Deserialize)]
|
||||
|
@ -287,6 +289,7 @@ impl Default for Settings {
|
|||
},
|
||||
grpc: Grpc {
|
||||
event_admission_server: None,
|
||||
restricts_write: false,
|
||||
},
|
||||
network: Network {
|
||||
port: 8080,
|
||||
|
@ -306,6 +309,7 @@ impl Default for Settings {
|
|||
event_persist_buffer: 4096,
|
||||
event_kind_blacklist: None,
|
||||
event_kind_allowlist: None,
|
||||
limit_scrapers: false
|
||||
},
|
||||
authorization: Authorization {
|
||||
pubkey_whitelist: None, // Allow any address to publish
|
||||
|
@ -320,7 +324,7 @@ impl Default for Settings {
|
|||
node_url: "".to_string(),
|
||||
api_secret: "".to_string(),
|
||||
sign_ups: false,
|
||||
direct_message: true,
|
||||
direct_message: false,
|
||||
secret_key: None,
|
||||
processor: Processor::LNBits,
|
||||
},
|
||||
|
|
14
src/conn.rs
14
src/conn.rs
|
@ -156,7 +156,7 @@ impl ClientConn {
|
|||
self.auth = Challenge(Uuid::new_v4().to_string());
|
||||
}
|
||||
|
||||
pub fn authenticate(&mut self, event: &Event, relay_url: &String) -> Result<()> {
|
||||
pub fn authenticate(&mut self, event: &Event, relay_url: &str) -> Result<()> {
|
||||
match &self.auth {
|
||||
Challenge(_) => (),
|
||||
AuthPubkey(_) => {
|
||||
|
@ -181,15 +181,15 @@ impl ClientConn {
|
|||
return Err(Error::AuthFailure);
|
||||
}
|
||||
|
||||
let mut challenge: Option<&String> = None;
|
||||
let mut relay: Option<&String> = None;
|
||||
let mut challenge: Option<&str> = None;
|
||||
let mut relay: Option<&str> = None;
|
||||
|
||||
for tag in &event.tags {
|
||||
if tag.len() == 2 && tag.get(0) == Some(&"challenge".into()) {
|
||||
challenge = tag.get(1);
|
||||
if tag.len() == 2 && tag.first() == Some(&"challenge".into()) {
|
||||
challenge = tag.get(1).map(|x| x.as_str());
|
||||
}
|
||||
if tag.len() == 2 && tag.get(0) == Some(&"relay".into()) {
|
||||
relay = tag.get(1);
|
||||
if tag.len() == 2 && tag.first() == Some(&"relay".into()) {
|
||||
relay = tag.get(1).map(|x| x.as_str());
|
||||
}
|
||||
}
|
||||
|
||||
|
|
|
@ -261,7 +261,7 @@ pub async fn db_writer(
|
|||
) => {
|
||||
// User does not exist
|
||||
info!("Unregistered user");
|
||||
if settings.pay_to_relay.sign_ups {
|
||||
if settings.pay_to_relay.sign_ups && settings.pay_to_relay.direct_message {
|
||||
payment_tx
|
||||
.send(PaymentMessage::NewAccount(event.pubkey))
|
||||
.ok();
|
||||
|
@ -401,6 +401,9 @@ pub async fn db_writer(
|
|||
start.elapsed()
|
||||
);
|
||||
event_write = true;
|
||||
|
||||
// send OK message
|
||||
notice_tx.try_send(Notice::saved(event.id)).ok();
|
||||
} else {
|
||||
match repo.write_event(&event).await {
|
||||
Ok(updated) => {
|
||||
|
|
18
src/event.rs
18
src/event.rs
|
@ -160,11 +160,11 @@ impl Event {
|
|||
.tags
|
||||
.iter()
|
||||
.filter(|x| !x.is_empty())
|
||||
.filter(|x| x.get(0).unwrap() == "expiration")
|
||||
.filter(|x| x.first().unwrap() == "expiration")
|
||||
.map(|x| x.get(1).unwrap_or(&default))
|
||||
.take(1)
|
||||
.collect();
|
||||
let val_first = dvals.get(0);
|
||||
let val_first = dvals.first();
|
||||
val_first.and_then(|t| t.parse::<u64>().ok())
|
||||
}
|
||||
|
||||
|
@ -192,11 +192,11 @@ impl Event {
|
|||
.tags
|
||||
.iter()
|
||||
.filter(|x| !x.is_empty())
|
||||
.filter(|x| x.get(0).unwrap() == "d")
|
||||
.filter(|x| x.first().unwrap() == "d")
|
||||
.map(|x| x.get(1).unwrap_or(&default))
|
||||
.take(1)
|
||||
.collect();
|
||||
let dval_first = dvals.get(0);
|
||||
let dval_first = dvals.first();
|
||||
match dval_first {
|
||||
Some(_) => dval_first.map(|x| x.to_string()),
|
||||
None => Some(default),
|
||||
|
@ -232,7 +232,7 @@ impl Event {
|
|||
.tags
|
||||
.iter()
|
||||
.filter(|x| x.len() == 4)
|
||||
.filter(|x| x.get(0).unwrap() == "delegation")
|
||||
.filter(|x| x.first().unwrap() == "delegation")
|
||||
.take(1)
|
||||
.next()?
|
||||
.clone(); // get first tag
|
||||
|
@ -277,7 +277,7 @@ impl Event {
|
|||
let mut idx: HashMap<char, HashSet<String>> = HashMap::new();
|
||||
// iterate over tags that have at least 2 elements
|
||||
for t in self.tags.iter().filter(|x| x.len() > 1) {
|
||||
let tagname = t.get(0).unwrap();
|
||||
let tagname = t.first().unwrap();
|
||||
let tagnamechar_opt = single_char_tagname(tagname);
|
||||
if tagnamechar_opt.is_none() {
|
||||
continue;
|
||||
|
@ -285,7 +285,7 @@ impl Event {
|
|||
let tagnamechar = tagnamechar_opt.unwrap();
|
||||
let tagval = t.get(1).unwrap();
|
||||
// ensure a vector exists for this tag
|
||||
idx.entry(tagnamechar).or_insert_with(HashSet::new);
|
||||
idx.entry(tagnamechar).or_default();
|
||||
// get the tag vec and insert entry
|
||||
let idx_tag_vec = idx.get_mut(&tagnamechar).expect("could not get tag vector");
|
||||
idx_tag_vec.insert(tagval.clone());
|
||||
|
@ -310,7 +310,7 @@ impl Event {
|
|||
self.tags
|
||||
.iter()
|
||||
.filter(|x| x.len() > 1)
|
||||
.filter(|x| x.get(0).unwrap() == tag_name)
|
||||
.filter(|x| x.first().unwrap() == tag_name)
|
||||
.map(|x| x.get(1).unwrap().clone())
|
||||
.collect()
|
||||
}
|
||||
|
@ -355,7 +355,7 @@ impl Event {
|
|||
return Err(EventInvalidId);
|
||||
}
|
||||
// * validate the message digest (sig) using the pubkey & computed sha256 message hash.
|
||||
let sig = schnorr::Signature::from_str(&self.sig).unwrap();
|
||||
let sig = schnorr::Signature::from_str(&self.sig).map_err(|_| EventInvalidSignature)?;
|
||||
if let Ok(msg) = secp256k1::Message::from_slice(digest.as_ref()) {
|
||||
if let Ok(pubkey) = XOnlyPublicKey::from_str(&self.pubkey) {
|
||||
SECP.verify_schnorr(&sig, &msg, &pubkey)
|
||||
|
|
159
src/hexrange.rs
159
src/hexrange.rs
|
@ -1,159 +0,0 @@
|
|||
//! Utilities for searching hexadecimal
|
||||
use crate::utils::is_hex;
|
||||
use hex;
|
||||
|
||||
/// Types of hexadecimal queries.
|
||||
#[derive(PartialEq, Eq, PartialOrd, Ord, Debug, Clone)]
|
||||
pub enum HexSearch {
|
||||
// when no range is needed, exact 32-byte
|
||||
Exact(Vec<u8>),
|
||||
// lower (inclusive) and upper range (exclusive)
|
||||
Range(Vec<u8>, Vec<u8>),
|
||||
// lower bound only, upper bound is MAX inclusive
|
||||
LowerOnly(Vec<u8>),
|
||||
}
|
||||
|
||||
/// Check if a string contains only f chars
|
||||
fn is_all_fs(s: &str) -> bool {
|
||||
s.chars().all(|x| x == 'f' || x == 'F')
|
||||
}
|
||||
|
||||
/// Find the next hex sequence greater than the argument.
|
||||
#[must_use]
|
||||
pub fn hex_range(s: &str) -> Option<HexSearch> {
|
||||
let mut hash_base = s.to_owned();
|
||||
if !is_hex(&hash_base) || hash_base.len() > 64 {
|
||||
return None;
|
||||
}
|
||||
if hash_base.len() == 64 {
|
||||
return Some(HexSearch::Exact(hex::decode(&hash_base).ok()?));
|
||||
}
|
||||
// if s is odd, add a zero
|
||||
let mut odd = hash_base.len() % 2 != 0;
|
||||
if odd {
|
||||
// extend the string to make it even
|
||||
hash_base.push('0');
|
||||
}
|
||||
let base = hex::decode(hash_base).ok()?;
|
||||
// check for all ff's
|
||||
if is_all_fs(s) {
|
||||
// there is no higher bound, we only want to search for blobs greater than this.
|
||||
return Some(HexSearch::LowerOnly(base));
|
||||
}
|
||||
|
||||
// return a range
|
||||
let mut upper = base.clone();
|
||||
let mut byte_len = upper.len();
|
||||
|
||||
// for odd strings, we made them longer, but we want to increment the upper char (+16).
|
||||
// we know we can do this without overflowing because we explicitly set the bottom half to 0's.
|
||||
while byte_len > 0 {
|
||||
byte_len -= 1;
|
||||
// check if byte can be incremented, or if we need to carry.
|
||||
let b = upper[byte_len];
|
||||
if b == u8::MAX {
|
||||
// reset and carry
|
||||
upper[byte_len] = 0;
|
||||
} else if odd {
|
||||
// check if first char in this byte is NOT 'f'
|
||||
if b < 240 {
|
||||
// bump up the first character in this byte
|
||||
upper[byte_len] = b + 16;
|
||||
// increment done, stop iterating through the vec
|
||||
break;
|
||||
}
|
||||
// if it is 'f', reset the byte to 0 and do a carry
|
||||
// reset and carry
|
||||
upper[byte_len] = 0;
|
||||
// done with odd logic, so don't repeat this
|
||||
odd = false;
|
||||
} else {
|
||||
// bump up the first character in this byte
|
||||
upper[byte_len] = b + 1;
|
||||
// increment done, stop iterating
|
||||
break;
|
||||
}
|
||||
}
|
||||
Some(HexSearch::Range(base, upper))
|
||||
}
|
||||
|
||||
#[cfg(test)]
|
||||
mod tests {
|
||||
use super::*;
|
||||
use crate::error::Result;
|
||||
|
||||
#[test]
|
||||
fn hex_range_exact() -> Result<()> {
|
||||
let hex = "abcdef00abcdef00abcdef00abcdef00abcdef00abcdef00abcdef00abcdef00";
|
||||
let r = hex_range(hex);
|
||||
assert_eq!(
|
||||
r,
|
||||
Some(HexSearch::Exact(hex::decode(hex).expect("invalid hex")))
|
||||
);
|
||||
Ok(())
|
||||
}
|
||||
#[test]
|
||||
fn hex_full_range() -> Result<()> {
|
||||
let hex = "aaaa";
|
||||
let hex_upper = "aaab";
|
||||
let r = hex_range(hex);
|
||||
assert_eq!(
|
||||
r,
|
||||
Some(HexSearch::Range(
|
||||
hex::decode(hex).expect("invalid hex"),
|
||||
hex::decode(hex_upper).expect("invalid hex")
|
||||
))
|
||||
);
|
||||
Ok(())
|
||||
}
|
||||
|
||||
#[test]
|
||||
fn hex_full_range_odd() -> Result<()> {
|
||||
let r = hex_range("abc");
|
||||
assert_eq!(
|
||||
r,
|
||||
Some(HexSearch::Range(
|
||||
hex::decode("abc0").expect("invalid hex"),
|
||||
hex::decode("abd0").expect("invalid hex")
|
||||
))
|
||||
);
|
||||
Ok(())
|
||||
}
|
||||
|
||||
#[test]
|
||||
fn hex_full_range_odd_end_f() -> Result<()> {
|
||||
let r = hex_range("abf");
|
||||
assert_eq!(
|
||||
r,
|
||||
Some(HexSearch::Range(
|
||||
hex::decode("abf0").expect("invalid hex"),
|
||||
hex::decode("ac00").expect("invalid hex")
|
||||
))
|
||||
);
|
||||
Ok(())
|
||||
}
|
||||
|
||||
#[test]
|
||||
fn hex_no_upper() -> Result<()> {
|
||||
let r = hex_range("ffff");
|
||||
assert_eq!(
|
||||
r,
|
||||
Some(HexSearch::LowerOnly(
|
||||
hex::decode("ffff").expect("invalid hex")
|
||||
))
|
||||
);
|
||||
Ok(())
|
||||
}
|
||||
|
||||
#[test]
|
||||
fn hex_no_upper_odd() -> Result<()> {
|
||||
let r = hex_range("fff");
|
||||
assert_eq!(
|
||||
r,
|
||||
Some(HexSearch::LowerOnly(
|
||||
hex::decode("fff0").expect("invalid hex")
|
||||
))
|
||||
);
|
||||
Ok(())
|
||||
}
|
||||
}
|
19
src/info.rs
19
src/info.rs
|
@ -4,7 +4,7 @@ use crate::config::Settings;
|
|||
use serde::{Deserialize, Serialize};
|
||||
|
||||
pub const CARGO_PKG_VERSION: Option<&'static str> = option_env!("CARGO_PKG_VERSION");
|
||||
pub const UNIT: &str = "sats";
|
||||
pub const UNIT: &str = "msats";
|
||||
|
||||
/// Limitations of the relay as specified in NIP-111
|
||||
/// (This nip isn't finalized so may change)
|
||||
|
@ -13,6 +13,9 @@ pub const UNIT: &str = "sats";
|
|||
pub struct Limitation {
|
||||
#[serde(skip_serializing_if = "Option::is_none")]
|
||||
payment_required: Option<bool>,
|
||||
|
||||
#[serde(skip_serializing_if = "Option::is_none")]
|
||||
restricted_writes: Option<bool>,
|
||||
}
|
||||
|
||||
#[derive(Serialize, Deserialize, Debug)]
|
||||
|
@ -45,7 +48,7 @@ pub struct RelayInfo {
|
|||
#[serde(skip_serializing_if = "Option::is_none")]
|
||||
pub contact: Option<String>,
|
||||
#[serde(skip_serializing_if = "Option::is_none")]
|
||||
pub icon: Option<String>,
|
||||
pub icon: Option<String>,
|
||||
#[serde(skip_serializing_if = "Option::is_none")]
|
||||
pub supported_nips: Option<Vec<i64>>,
|
||||
#[serde(skip_serializing_if = "Option::is_none")]
|
||||
|
@ -63,7 +66,7 @@ pub struct RelayInfo {
|
|||
/// Convert an Info configuration into public Relay Info
|
||||
impl From<Settings> for RelayInfo {
|
||||
fn from(c: Settings) -> Self {
|
||||
let mut supported_nips = vec![1, 2, 9, 11, 12, 15, 16, 20, 22, 33, 40, 42];
|
||||
let mut supported_nips = vec![1, 2, 9, 11, 12, 15, 16, 20, 22, 33, 40];
|
||||
|
||||
if c.authorization.nip42_auth {
|
||||
supported_nips.push(42);
|
||||
|
@ -75,12 +78,18 @@ impl From<Settings> for RelayInfo {
|
|||
|
||||
let limitations = Limitation {
|
||||
payment_required: Some(p.enabled),
|
||||
restricted_writes: Some(
|
||||
p.enabled
|
||||
|| c.verified_users.is_enabled()
|
||||
|| c.authorization.pubkey_whitelist.is_some()
|
||||
|| c.grpc.restricts_write,
|
||||
),
|
||||
};
|
||||
|
||||
let (payment_url, fees) = if p.enabled {
|
||||
let admission_fee = if p.admission_cost > 0 {
|
||||
Some(vec![Fee {
|
||||
amount: p.admission_cost,
|
||||
amount: p.admission_cost * 1000,
|
||||
unit: UNIT.to_string(),
|
||||
}])
|
||||
} else {
|
||||
|
@ -89,7 +98,7 @@ impl From<Settings> for RelayInfo {
|
|||
|
||||
let post_fee = if p.cost_per_event > 0 {
|
||||
Some(vec![Fee {
|
||||
amount: p.cost_per_event,
|
||||
amount: p.cost_per_event * 1000,
|
||||
unit: UNIT.to_string(),
|
||||
}])
|
||||
} else {
|
||||
|
|
|
@ -6,7 +6,6 @@ pub mod db;
|
|||
pub mod delegation;
|
||||
pub mod error;
|
||||
pub mod event;
|
||||
pub mod hexrange;
|
||||
pub mod info;
|
||||
pub mod nauthz;
|
||||
pub mod nip05;
|
||||
|
|
|
@ -41,7 +41,7 @@ impl std::convert::From<Nip05Name> for nauthz_grpc::event_request::Nip05Name {
|
|||
}
|
||||
|
||||
// conversion of event tags into gprc struct
|
||||
fn tags_to_protobuf(tags: &Vec<Vec<String>>) -> Vec<TagEntry> {
|
||||
fn tags_to_protobuf(tags: &[Vec<String>]) -> Vec<TagEntry> {
|
||||
tags.iter()
|
||||
.map(|x| TagEntry { values: x.clone() })
|
||||
.collect()
|
||||
|
|
|
@ -11,7 +11,7 @@ use crate::repo::NostrRepo;
|
|||
use hyper::body::HttpBody;
|
||||
use hyper::client::connect::HttpConnector;
|
||||
use hyper::Client;
|
||||
use hyper_tls::HttpsConnector;
|
||||
use hyper_rustls::HttpsConnector;
|
||||
use std::sync::Arc;
|
||||
use std::time::Duration;
|
||||
use std::time::Instant;
|
||||
|
@ -133,7 +133,12 @@ impl Verifier {
|
|||
) -> Result<Self> {
|
||||
info!("creating NIP-05 verifier");
|
||||
// setup hyper client
|
||||
let https = HttpsConnector::new();
|
||||
let https = hyper_rustls::HttpsConnectorBuilder::new()
|
||||
.with_native_roots()
|
||||
.https_or_http()
|
||||
.enable_http1()
|
||||
.build();
|
||||
|
||||
let client = Client::builder().build::<_, hyper::Body>(https);
|
||||
|
||||
// After all accounts have been re-verified, don't check again
|
||||
|
|
|
@ -2,7 +2,7 @@
|
|||
use http::Uri;
|
||||
use hyper::client::connect::HttpConnector;
|
||||
use hyper::Client;
|
||||
use hyper_tls::HttpsConnector;
|
||||
use hyper_rustls::HttpsConnector;
|
||||
use nostr::Keys;
|
||||
use serde::{Deserialize, Serialize};
|
||||
use serde_json::Value;
|
||||
|
@ -72,7 +72,11 @@ pub struct LNBitsPaymentProcessor {
|
|||
impl LNBitsPaymentProcessor {
|
||||
pub fn new(settings: &Settings) -> Self {
|
||||
// setup hyper client
|
||||
let https = HttpsConnector::new();
|
||||
let https = hyper_rustls::HttpsConnectorBuilder::new()
|
||||
.with_native_roots()
|
||||
.https_only()
|
||||
.enable_http1()
|
||||
.build();
|
||||
let client = Client::builder().build::<_, hyper::Body>(https);
|
||||
|
||||
Self {
|
||||
|
|
|
@ -14,7 +14,6 @@ use sqlx::{Error, Execute, FromRow, Postgres, QueryBuilder, Row};
|
|||
use std::time::{Duration, Instant};
|
||||
|
||||
use crate::error;
|
||||
use crate::hexrange::{hex_range, HexSearch};
|
||||
use crate::repo::postgres_migration::run_migrations;
|
||||
use crate::server::NostrMetrics;
|
||||
use crate::utils::{self, is_hex, is_lower_hex};
|
||||
|
@ -637,14 +636,14 @@ ON CONFLICT (id) DO NOTHING"#,
|
|||
sqlx::query(
|
||||
"INSERT INTO invoice (pubkey, payment_hash, amount, status, description, created_at, invoice) VALUES ($1, $2, $3, $4, $5, now(), $6)",
|
||||
)
|
||||
.bind(pub_key)
|
||||
.bind(invoice_info.payment_hash)
|
||||
.bind(invoice_info.amount as i64)
|
||||
.bind(invoice_info.status)
|
||||
.bind(invoice_info.memo)
|
||||
.bind(invoice_info.bolt11)
|
||||
.execute(&mut tx)
|
||||
.await.unwrap();
|
||||
.bind(pub_key)
|
||||
.bind(invoice_info.payment_hash)
|
||||
.bind(invoice_info.amount as i64)
|
||||
.bind(invoice_info.status)
|
||||
.bind(invoice_info.memo)
|
||||
.bind(invoice_info.bolt11)
|
||||
.execute(&mut tx)
|
||||
.await.unwrap();
|
||||
|
||||
debug!("Invoice added");
|
||||
|
||||
|
@ -733,140 +732,62 @@ fn query_from_filter(f: &ReqFilter) -> Option<QueryBuilder<Postgres>> {
|
|||
// filter out non-hex values
|
||||
let auth_vec: Vec<&String> = auth_vec.iter().filter(|a| is_hex(a)).collect();
|
||||
|
||||
if !auth_vec.is_empty() {
|
||||
query.push("(");
|
||||
|
||||
// shortcut authors into "IN" query
|
||||
let any_is_range = auth_vec.iter().any(|pk| pk.len() != 64);
|
||||
if !any_is_range {
|
||||
query.push("e.pub_key in (");
|
||||
let mut pk_sep = query.separated(", ");
|
||||
for pk in auth_vec.iter() {
|
||||
pk_sep.push_bind(hex::decode(pk).ok());
|
||||
}
|
||||
query.push(") OR e.delegated_by in (");
|
||||
let mut pk_delegated_sep = query.separated(", ");
|
||||
for pk in auth_vec.iter() {
|
||||
pk_delegated_sep.push_bind(hex::decode(pk).ok());
|
||||
}
|
||||
query.push(")");
|
||||
push_and = true;
|
||||
} else {
|
||||
let mut range_authors = query.separated(" OR ");
|
||||
for auth in auth_vec {
|
||||
match hex_range(auth) {
|
||||
Some(HexSearch::Exact(ex)) => {
|
||||
range_authors
|
||||
.push("(e.pub_key = ")
|
||||
.push_bind_unseparated(ex.clone())
|
||||
.push_unseparated(" OR e.delegated_by = ")
|
||||
.push_bind_unseparated(ex)
|
||||
.push_unseparated(")");
|
||||
}
|
||||
Some(HexSearch::Range(lower, upper)) => {
|
||||
range_authors
|
||||
.push("((e.pub_key > ")
|
||||
.push_bind_unseparated(lower.clone())
|
||||
.push_unseparated(" AND e.pub_key < ")
|
||||
.push_bind_unseparated(upper.clone())
|
||||
.push_unseparated(") OR (e.delegated_by > ")
|
||||
.push_bind_unseparated(lower)
|
||||
.push_unseparated(" AND e.delegated_by < ")
|
||||
.push_bind_unseparated(upper)
|
||||
.push_unseparated("))");
|
||||
}
|
||||
Some(HexSearch::LowerOnly(lower)) => {
|
||||
range_authors
|
||||
.push("(e.pub_key > ")
|
||||
.push_bind_unseparated(lower.clone())
|
||||
.push_unseparated(" OR e.delegated_by > ")
|
||||
.push_bind_unseparated(lower)
|
||||
.push_unseparated(")");
|
||||
}
|
||||
None => {
|
||||
info!("Could not parse hex range from author {:?}", auth);
|
||||
}
|
||||
}
|
||||
push_and = true;
|
||||
}
|
||||
}
|
||||
query.push(")");
|
||||
if auth_vec.is_empty() {
|
||||
return None;
|
||||
}
|
||||
query.push("(e.pub_key in (");
|
||||
|
||||
let mut pk_sep = query.separated(", ");
|
||||
for pk in auth_vec.iter() {
|
||||
pk_sep.push_bind(hex::decode(pk).ok());
|
||||
}
|
||||
query.push(") OR e.delegated_by in (");
|
||||
let mut pk_delegated_sep = query.separated(", ");
|
||||
for pk in auth_vec.iter() {
|
||||
pk_delegated_sep.push_bind(hex::decode(pk).ok());
|
||||
}
|
||||
push_and = true;
|
||||
query.push("))");
|
||||
}
|
||||
|
||||
// Query for Kind
|
||||
if let Some(ks) = &f.kinds {
|
||||
if !ks.is_empty() {
|
||||
if push_and {
|
||||
query.push(" AND ");
|
||||
}
|
||||
push_and = true;
|
||||
|
||||
query.push("e.kind in (");
|
||||
let mut list_query = query.separated(", ");
|
||||
for k in ks.iter() {
|
||||
list_query.push_bind(*k as i64);
|
||||
}
|
||||
query.push(")");
|
||||
if ks.is_empty() {
|
||||
return None;
|
||||
}
|
||||
if push_and {
|
||||
query.push(" AND ");
|
||||
}
|
||||
push_and = true;
|
||||
|
||||
query.push("e.kind in (");
|
||||
let mut list_query = query.separated(", ");
|
||||
for k in ks.iter() {
|
||||
list_query.push_bind(*k as i64);
|
||||
}
|
||||
query.push(")");
|
||||
}
|
||||
|
||||
// Query for event, allowing prefix matches
|
||||
// Query for event,
|
||||
if let Some(id_vec) = &f.ids {
|
||||
// filter out non-hex values
|
||||
let id_vec: Vec<&String> = id_vec.iter().filter(|a| is_hex(a)).collect();
|
||||
|
||||
if !id_vec.is_empty() {
|
||||
if push_and {
|
||||
query.push(" AND (");
|
||||
} else {
|
||||
query.push("(");
|
||||
}
|
||||
push_and = true;
|
||||
|
||||
// shortcut ids into "IN" query
|
||||
let any_is_range = id_vec.iter().any(|pk| pk.len() != 64);
|
||||
if !any_is_range {
|
||||
query.push("id in (");
|
||||
let mut sep = query.separated(", ");
|
||||
for id in id_vec.iter() {
|
||||
sep.push_bind(hex::decode(id).ok());
|
||||
}
|
||||
query.push(")");
|
||||
} else {
|
||||
// take each author and convert to a hex search
|
||||
let mut id_query = query.separated(" OR ");
|
||||
for id in id_vec {
|
||||
match hex_range(id) {
|
||||
Some(HexSearch::Exact(ex)) => {
|
||||
id_query
|
||||
.push("(id = ")
|
||||
.push_bind_unseparated(ex)
|
||||
.push_unseparated(")");
|
||||
}
|
||||
Some(HexSearch::Range(lower, upper)) => {
|
||||
id_query
|
||||
.push("(id > ")
|
||||
.push_bind_unseparated(lower)
|
||||
.push_unseparated(" AND id < ")
|
||||
.push_bind_unseparated(upper)
|
||||
.push_unseparated(")");
|
||||
}
|
||||
Some(HexSearch::LowerOnly(lower)) => {
|
||||
id_query
|
||||
.push("(id > ")
|
||||
.push_bind_unseparated(lower)
|
||||
.push_unseparated(")");
|
||||
}
|
||||
None => {
|
||||
info!("Could not parse hex range from id {:?}", id);
|
||||
}
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
query.push(")");
|
||||
if id_vec.is_empty() {
|
||||
return None;
|
||||
}
|
||||
if push_and {
|
||||
query.push(" AND (");
|
||||
} else {
|
||||
query.push("(");
|
||||
}
|
||||
push_and = true;
|
||||
|
||||
query.push("id in (");
|
||||
let mut sep = query.separated(", ");
|
||||
for id in id_vec.iter() {
|
||||
sep.push_bind(hex::decode(id).ok());
|
||||
}
|
||||
query.push("))");
|
||||
}
|
||||
|
||||
// Query for tags
|
||||
|
@ -877,22 +798,46 @@ fn query_from_filter(f: &ReqFilter) -> Option<QueryBuilder<Postgres>> {
|
|||
}
|
||||
push_and = true;
|
||||
|
||||
let mut push_or = false;
|
||||
query.push("e.id IN (SELECT ee.id FROM \"event\" ee LEFT JOIN tag t on ee.id = t.event_id WHERE ee.hidden != 1::bit(1) and ");
|
||||
for (key, val) in map.iter() {
|
||||
query.push("e.id IN (SELECT ee.id FROM \"event\" ee LEFT JOIN tag t on ee.id = t.event_id WHERE ee.hidden != 1::bit(1) and (t.\"name\" = ")
|
||||
if val.is_empty() {
|
||||
return None;
|
||||
}
|
||||
if push_or {
|
||||
query.push(" OR ");
|
||||
}
|
||||
query
|
||||
.push("(t.\"name\" = ")
|
||||
.push_bind(key.to_string())
|
||||
.push(" AND (value in (");
|
||||
.push(" AND (");
|
||||
|
||||
// plain value match first
|
||||
let mut tag_query = query.separated(", ");
|
||||
for v in val.iter() {
|
||||
if (v.len() % 2 != 0) && !is_lower_hex(v) {
|
||||
let has_plain_values = val.iter().any(|v| (v.len() % 2 != 0 || !is_lower_hex(v)));
|
||||
let has_hex_values = val.iter().any(|v| v.len() % 2 == 0 && is_lower_hex(v));
|
||||
if has_plain_values {
|
||||
query.push("value in (");
|
||||
// plain value match first
|
||||
let mut tag_query = query.separated(", ");
|
||||
for v in val.iter().filter(|v| v.len() % 2 != 0 || !is_lower_hex(v)) {
|
||||
tag_query.push_bind(v.as_bytes());
|
||||
} else {
|
||||
}
|
||||
}
|
||||
if has_plain_values && has_hex_values {
|
||||
query.push(") OR ");
|
||||
}
|
||||
if has_hex_values {
|
||||
query.push("value_hex in (");
|
||||
// plain value match first
|
||||
let mut tag_query = query.separated(", ");
|
||||
for v in val.iter().filter(|v| v.len() % 2 == 0 && is_lower_hex(v)) {
|
||||
tag_query.push_bind(hex::decode(v).ok());
|
||||
}
|
||||
}
|
||||
query.push("))))");
|
||||
|
||||
query.push(")))");
|
||||
push_or = true;
|
||||
}
|
||||
query.push(")");
|
||||
}
|
||||
}
|
||||
|
||||
|
@ -925,10 +870,7 @@ fn query_from_filter(f: &ReqFilter) -> Option<QueryBuilder<Postgres>> {
|
|||
query.push("e.hidden != 1::bit(1)");
|
||||
}
|
||||
// never display expired events
|
||||
query
|
||||
.push(" AND (e.expires_at IS NULL OR e.expires_at > ")
|
||||
.push_bind(Utc.timestamp_opt(utils::unix_time() as i64, 0).unwrap())
|
||||
.push(")");
|
||||
query.push(" AND (e.expires_at IS NULL OR e.expires_at > now())");
|
||||
|
||||
// Apply per-filter limit to this query.
|
||||
// The use of a LIMIT implies a DESC order, to capture only the most recent events.
|
||||
|
@ -963,3 +905,111 @@ impl FromRow<'_, PgRow> for VerificationRecord {
|
|||
})
|
||||
}
|
||||
}
|
||||
|
||||
#[cfg(test)]
|
||||
mod tests {
|
||||
use super::*;
|
||||
use std::collections::{HashMap, HashSet};
|
||||
|
||||
#[test]
|
||||
fn test_query_gen_tag_value_hex() {
|
||||
let filter = ReqFilter {
|
||||
ids: None,
|
||||
kinds: Some(vec![1000]),
|
||||
since: None,
|
||||
until: None,
|
||||
authors: Some(vec![
|
||||
"84de35e2584d2b144aae823c9ed0b0f3deda09648530b93d1a2a146d1dea9864".to_owned(),
|
||||
]),
|
||||
limit: None,
|
||||
tags: Some(HashMap::from([(
|
||||
'p',
|
||||
HashSet::from([
|
||||
"63fe6318dc58583cfe16810f86dd09e18bfd76aabc24a0081ce2856f330504ed".to_owned(),
|
||||
]),
|
||||
)])),
|
||||
force_no_match: false,
|
||||
};
|
||||
|
||||
let q = query_from_filter(&filter).unwrap();
|
||||
assert_eq!(q.sql(), "SELECT e.\"content\", e.created_at FROM \"event\" e WHERE (e.pub_key in ($1) OR e.delegated_by in ($2)) AND e.kind in ($3) AND e.id IN (SELECT ee.id FROM \"event\" ee LEFT JOIN tag t on ee.id = t.event_id WHERE ee.hidden != 1::bit(1) and (t.\"name\" = $4 AND (value_hex in ($5)))) AND e.hidden != 1::bit(1) AND (e.expires_at IS NULL OR e.expires_at > now()) ORDER BY e.created_at ASC LIMIT 1000")
|
||||
}
|
||||
|
||||
#[test]
|
||||
fn test_query_gen_tag_value() {
|
||||
let filter = ReqFilter {
|
||||
ids: None,
|
||||
kinds: Some(vec![1000]),
|
||||
since: None,
|
||||
until: None,
|
||||
authors: Some(vec![
|
||||
"84de35e2584d2b144aae823c9ed0b0f3deda09648530b93d1a2a146d1dea9864".to_owned(),
|
||||
]),
|
||||
limit: None,
|
||||
tags: Some(HashMap::from([('d', HashSet::from(["test".to_owned()]))])),
|
||||
force_no_match: false,
|
||||
};
|
||||
|
||||
let q = query_from_filter(&filter).unwrap();
|
||||
assert_eq!(q.sql(), "SELECT e.\"content\", e.created_at FROM \"event\" e WHERE (e.pub_key in ($1) OR e.delegated_by in ($2)) AND e.kind in ($3) AND e.id IN (SELECT ee.id FROM \"event\" ee LEFT JOIN tag t on ee.id = t.event_id WHERE ee.hidden != 1::bit(1) and (t.\"name\" = $4 AND (value in ($5)))) AND e.hidden != 1::bit(1) AND (e.expires_at IS NULL OR e.expires_at > now()) ORDER BY e.created_at ASC LIMIT 1000")
|
||||
}
|
||||
|
||||
#[test]
|
||||
fn test_query_gen_tag_value_and_value_hex() {
|
||||
let filter = ReqFilter {
|
||||
ids: None,
|
||||
kinds: Some(vec![1000]),
|
||||
since: None,
|
||||
until: None,
|
||||
authors: Some(vec![
|
||||
"84de35e2584d2b144aae823c9ed0b0f3deda09648530b93d1a2a146d1dea9864".to_owned(),
|
||||
]),
|
||||
limit: None,
|
||||
tags: Some(HashMap::from([(
|
||||
'd',
|
||||
HashSet::from([
|
||||
"test".to_owned(),
|
||||
"63fe6318dc58583cfe16810f86dd09e18bfd76aabc24a0081ce2856f330504ed".to_owned(),
|
||||
]),
|
||||
)])),
|
||||
force_no_match: false,
|
||||
};
|
||||
|
||||
let q = query_from_filter(&filter).unwrap();
|
||||
assert_eq!(q.sql(), "SELECT e.\"content\", e.created_at FROM \"event\" e WHERE (e.pub_key in ($1) OR e.delegated_by in ($2)) AND e.kind in ($3) AND e.id IN (SELECT ee.id FROM \"event\" ee LEFT JOIN tag t on ee.id = t.event_id WHERE ee.hidden != 1::bit(1) and (t.\"name\" = $4 AND (value in ($5) OR value_hex in ($6)))) AND e.hidden != 1::bit(1) AND (e.expires_at IS NULL OR e.expires_at > now()) ORDER BY e.created_at ASC LIMIT 1000")
|
||||
}
|
||||
|
||||
#[test]
|
||||
fn test_query_multiple_tags() {
|
||||
let filter = ReqFilter {
|
||||
ids: None,
|
||||
kinds: Some(vec![30_001]),
|
||||
since: None,
|
||||
until: None,
|
||||
authors: None,
|
||||
limit: None,
|
||||
tags: Some(HashMap::from([
|
||||
('d', HashSet::from(["follow".to_owned()])),
|
||||
('t', HashSet::from(["siamstr".to_owned()])),
|
||||
])),
|
||||
force_no_match: false,
|
||||
};
|
||||
let q = query_from_filter(&filter).unwrap();
|
||||
assert_eq!(q.sql(), "SELECT e.\"content\", e.created_at FROM \"event\" e WHERE e.kind in ($1) AND e.id IN (SELECT ee.id FROM \"event\" ee LEFT JOIN tag t on ee.id = t.event_id WHERE ee.hidden != 1::bit(1) and (t.\"name\" = $2 AND (value in ($3))) OR (t.\"name\" = $4 AND (value in ($5)))) AND e.hidden != 1::bit(1) AND (e.expires_at IS NULL OR e.expires_at > now()) ORDER BY e.created_at ASC LIMIT 1000")
|
||||
}
|
||||
|
||||
#[test]
|
||||
fn test_query_empty_tags() {
|
||||
let filter = ReqFilter {
|
||||
ids: None,
|
||||
kinds: Some(vec![1, 6, 16, 30023, 1063, 6969]),
|
||||
since: Some(1700697846),
|
||||
until: None,
|
||||
authors: None,
|
||||
limit: None,
|
||||
tags: Some(HashMap::from([('a', HashSet::new())])),
|
||||
force_no_match: false,
|
||||
};
|
||||
assert!(query_from_filter(&filter).is_none());
|
||||
}
|
||||
}
|
||||
|
|
|
@ -205,7 +205,7 @@ CREATE INDEX tag_value_hex_idx ON tag USING btree (value_hex);
|
|||
let event: Event = serde_json::from_str(&String::from_utf8(event_bytes).unwrap())?;
|
||||
|
||||
for t in event.tags.iter().filter(|x| x.len() > 1) {
|
||||
let tagname = t.get(0).unwrap();
|
||||
let tagname = t.first().unwrap();
|
||||
let tagnamechar_opt = single_char_tagname(tagname);
|
||||
if tagnamechar_opt.is_none() {
|
||||
continue;
|
||||
|
|
|
@ -4,8 +4,6 @@ use crate::config::Settings;
|
|||
use crate::db::QueryResult;
|
||||
use crate::error::{Error::SqlError, Result};
|
||||
use crate::event::{single_char_tagname, Event};
|
||||
use crate::hexrange::hex_range;
|
||||
use crate::hexrange::HexSearch;
|
||||
use crate::nip05::{Nip05Name, VerificationRecord};
|
||||
use crate::payment::{InvoiceInfo, InvoiceStatus};
|
||||
use crate::repo::sqlite_migration::{upgrade_db, STARTUP_SQL};
|
||||
|
@ -994,24 +992,9 @@ fn query_from_filter(f: &ReqFilter) -> (String, Vec<Box<dyn ToSql>>, Option<Stri
|
|||
// take each author and convert to a hexsearch
|
||||
let mut auth_searches: Vec<String> = vec![];
|
||||
for auth in authvec {
|
||||
match hex_range(auth) {
|
||||
Some(HexSearch::Exact(ex)) => {
|
||||
auth_searches.push("author=?".to_owned());
|
||||
params.push(Box::new(ex));
|
||||
}
|
||||
Some(HexSearch::Range(lower, upper)) => {
|
||||
auth_searches.push("(author>? AND author<?)".to_owned());
|
||||
params.push(Box::new(lower));
|
||||
params.push(Box::new(upper));
|
||||
}
|
||||
Some(HexSearch::LowerOnly(lower)) => {
|
||||
auth_searches.push("author>?".to_owned());
|
||||
params.push(Box::new(lower));
|
||||
}
|
||||
None => {
|
||||
trace!("Could not parse hex range from author {:?}", auth);
|
||||
}
|
||||
}
|
||||
auth_searches.push("author=?".to_owned());
|
||||
let auth_bin = hex::decode(auth).ok();
|
||||
params.push(Box::new(auth_bin));
|
||||
}
|
||||
if !authvec.is_empty() {
|
||||
let auth_clause = format!("({})", auth_searches.join(" OR "));
|
||||
|
@ -1032,24 +1015,8 @@ fn query_from_filter(f: &ReqFilter) -> (String, Vec<Box<dyn ToSql>>, Option<Stri
|
|||
// take each author and convert to a hexsearch
|
||||
let mut id_searches: Vec<String> = vec![];
|
||||
for id in idvec {
|
||||
match hex_range(id) {
|
||||
Some(HexSearch::Exact(ex)) => {
|
||||
id_searches.push("event_hash=?".to_owned());
|
||||
params.push(Box::new(ex));
|
||||
}
|
||||
Some(HexSearch::Range(lower, upper)) => {
|
||||
id_searches.push("(event_hash>? AND event_hash<?)".to_owned());
|
||||
params.push(Box::new(lower));
|
||||
params.push(Box::new(upper));
|
||||
}
|
||||
Some(HexSearch::LowerOnly(lower)) => {
|
||||
id_searches.push("event_hash>?".to_owned());
|
||||
params.push(Box::new(lower));
|
||||
}
|
||||
None => {
|
||||
info!("Could not parse hex range from id {:?}", id);
|
||||
}
|
||||
}
|
||||
id_searches.push("event_hash=?".to_owned());
|
||||
params.push(Box::new(id.clone()));
|
||||
}
|
||||
if idvec.is_empty() {
|
||||
// if the ids list was empty, we should never return
|
||||
|
@ -1072,8 +1039,6 @@ fn query_from_filter(f: &ReqFilter) -> (String, Vec<Box<dyn ToSql>>, Option<Stri
|
|||
// find evidence of the target tag name/value existing for this event.
|
||||
// Query for Kind/Since/Until additionally, to reduce the number of tags that come back.
|
||||
let kind_clause;
|
||||
let since_clause;
|
||||
let until_clause;
|
||||
if let Some(ks) = &f.kinds {
|
||||
// kind is number, no escaping needed
|
||||
let str_kinds: Vec<String> =
|
||||
|
@ -1082,16 +1047,16 @@ fn query_from_filter(f: &ReqFilter) -> (String, Vec<Box<dyn ToSql>>, Option<Stri
|
|||
} else {
|
||||
kind_clause = String::new();
|
||||
};
|
||||
if f.since.is_some() {
|
||||
since_clause = format!("AND created_at >= {}", f.since.unwrap());
|
||||
let since_clause = if f.since.is_some() {
|
||||
format!("AND created_at >= {}", f.since.unwrap())
|
||||
} else {
|
||||
since_clause = String::new();
|
||||
String::new()
|
||||
};
|
||||
// Query for timestamp
|
||||
if f.until.is_some() {
|
||||
until_clause = format!("AND created_at <= {}", f.until.unwrap());
|
||||
let until_clause = if f.until.is_some() {
|
||||
format!("AND created_at <= {}", f.until.unwrap())
|
||||
} else {
|
||||
until_clause = String::new();
|
||||
String::new()
|
||||
};
|
||||
|
||||
let tag_clause = format!(
|
||||
|
@ -1317,6 +1282,7 @@ pub async fn db_checkpoint_task(
|
|||
}
|
||||
|
||||
#[derive(Debug)]
|
||||
#[allow(dead_code)]
|
||||
enum SqliteStatus {
|
||||
Ok,
|
||||
Busy,
|
||||
|
|
|
@ -159,7 +159,7 @@ fn mig_init(conn: &mut PooledConnection) -> usize {
|
|||
);
|
||||
}
|
||||
Err(err) => {
|
||||
error!("update failed: {}", err);
|
||||
error!("update (init) failed: {}", err);
|
||||
panic!("database could not be initialized");
|
||||
}
|
||||
}
|
||||
|
@ -295,7 +295,7 @@ pub fn rebuild_tags(conn: &mut PooledConnection) -> Result<()> {
|
|||
let event: Event = serde_json::from_str(&event_json)?;
|
||||
// look at each event, and each tag, creating new tag entries if appropriate.
|
||||
for t in event.tags.iter().filter(|x| x.len() > 1) {
|
||||
let tagname = t.get(0).unwrap();
|
||||
let tagname = t.first().unwrap();
|
||||
let tagnamechar_opt = single_char_tagname(tagname);
|
||||
if tagnamechar_opt.is_none() {
|
||||
continue;
|
||||
|
@ -325,7 +325,7 @@ pub fn rebuild_tags(conn: &mut PooledConnection) -> Result<()> {
|
|||
Ok(())
|
||||
}
|
||||
|
||||
//// Migration Scripts
|
||||
// Migration Scripts
|
||||
|
||||
fn mig_1_to_2(conn: &mut PooledConnection) -> Result<usize> {
|
||||
// only change is adding a hidden column to events.
|
||||
|
@ -339,7 +339,7 @@ PRAGMA user_version = 2;
|
|||
info!("database schema upgraded v1 -> v2");
|
||||
}
|
||||
Err(err) => {
|
||||
error!("update failed: {}", err);
|
||||
error!("update (v1->v2) failed: {}", err);
|
||||
panic!("database could not be upgraded");
|
||||
}
|
||||
}
|
||||
|
@ -366,7 +366,7 @@ PRAGMA user_version = 3;
|
|||
info!("database schema upgraded v2 -> v3");
|
||||
}
|
||||
Err(err) => {
|
||||
error!("update failed: {}", err);
|
||||
error!("update (v2->v3) failed: {}", err);
|
||||
panic!("database could not be upgraded");
|
||||
}
|
||||
}
|
||||
|
@ -416,7 +416,7 @@ PRAGMA user_version = 4;
|
|||
info!("database schema upgraded v3 -> v4");
|
||||
}
|
||||
Err(err) => {
|
||||
error!("update failed: {}", err);
|
||||
error!("update (v3->v4) failed: {}", err);
|
||||
panic!("database could not be upgraded");
|
||||
}
|
||||
}
|
||||
|
@ -435,7 +435,7 @@ PRAGMA user_version=5;
|
|||
info!("database schema upgraded v4 -> v5");
|
||||
}
|
||||
Err(err) => {
|
||||
error!("update failed: {}", err);
|
||||
error!("update (v4->v5) failed: {}", err);
|
||||
panic!("database could not be upgraded");
|
||||
}
|
||||
}
|
||||
|
@ -461,7 +461,7 @@ fn mig_5_to_6(conn: &mut PooledConnection) -> Result<usize> {
|
|||
let event: Event = serde_json::from_str(&event_json)?;
|
||||
// look at each event, and each tag, creating new tag entries if appropriate.
|
||||
for t in event.tags.iter().filter(|x| x.len() > 1) {
|
||||
let tagname = t.get(0).unwrap();
|
||||
let tagname = t.first().unwrap();
|
||||
let tagnamechar_opt = single_char_tagname(tagname);
|
||||
if tagnamechar_opt.is_none() {
|
||||
continue;
|
||||
|
@ -507,7 +507,7 @@ PRAGMA user_version = 7;
|
|||
info!("database schema upgraded v6 -> v7");
|
||||
}
|
||||
Err(err) => {
|
||||
error!("update failed: {}", err);
|
||||
error!("update (v6->v7) failed: {}", err);
|
||||
panic!("database could not be upgraded");
|
||||
}
|
||||
}
|
||||
|
@ -528,7 +528,7 @@ PRAGMA user_version = 8;
|
|||
info!("database schema upgraded v7 -> v8");
|
||||
}
|
||||
Err(err) => {
|
||||
error!("update failed: {}", err);
|
||||
error!("update (v7->v8) failed: {}", err);
|
||||
panic!("database could not be upgraded");
|
||||
}
|
||||
}
|
||||
|
@ -548,7 +548,7 @@ PRAGMA user_version = 9;
|
|||
info!("database schema upgraded v8 -> v9");
|
||||
}
|
||||
Err(err) => {
|
||||
error!("update failed: {}", err);
|
||||
error!("update (v8->v9) failed: {}", err);
|
||||
panic!("database could not be upgraded");
|
||||
}
|
||||
}
|
||||
|
@ -567,7 +567,7 @@ PRAGMA user_version = 10;
|
|||
info!("database schema upgraded v9 -> v10");
|
||||
}
|
||||
Err(err) => {
|
||||
error!("update failed: {}", err);
|
||||
error!("update (v9->v10) failed: {}", err);
|
||||
panic!("database could not be upgraded");
|
||||
}
|
||||
}
|
||||
|
@ -588,7 +588,7 @@ PRAGMA user_version = 11;
|
|||
info!("database schema upgraded v10 -> v11");
|
||||
}
|
||||
Err(err) => {
|
||||
error!("update failed: {}", err);
|
||||
error!("update (v10->v11) failed: {}", err);
|
||||
panic!("database could not be upgraded");
|
||||
}
|
||||
}
|
||||
|
@ -643,7 +643,7 @@ PRAGMA user_version = 13;
|
|||
info!("database schema upgraded v12 -> v13");
|
||||
}
|
||||
Err(err) => {
|
||||
error!("update failed: {}", err);
|
||||
error!("update (v12->v13) failed: {}", err);
|
||||
panic!("database could not be upgraded");
|
||||
}
|
||||
}
|
||||
|
@ -663,7 +663,7 @@ PRAGMA user_version = 14;
|
|||
info!("database schema upgraded v13 -> v14");
|
||||
}
|
||||
Err(err) => {
|
||||
error!("update failed: {}", err);
|
||||
error!("update (v13->v14) failed: {}", err);
|
||||
panic!("database could not be upgraded");
|
||||
}
|
||||
}
|
||||
|
@ -682,7 +682,7 @@ PRAGMA user_version = 15;
|
|||
info!("database schema upgraded v14 -> v15");
|
||||
}
|
||||
Err(err) => {
|
||||
error!("update failed: {}", err);
|
||||
error!("update (v14->v15) failed: {}", err);
|
||||
panic!("database could not be upgraded");
|
||||
}
|
||||
}
|
||||
|
@ -749,7 +749,7 @@ CREATE INDEX IF NOT EXISTS tag_covering_index ON tag(name,kind,value,created_at,
|
|||
let event: Event = serde_json::from_str(&event_json)?;
|
||||
// look at each event, and each tag, creating new tag entries if appropriate.
|
||||
for t in event.tags.iter().filter(|x| x.len() > 1) {
|
||||
let tagname = t.get(0).unwrap();
|
||||
let tagname = t.first().unwrap();
|
||||
let tagnamechar_opt = single_char_tagname(tagname);
|
||||
if tagnamechar_opt.is_none() {
|
||||
continue;
|
||||
|
@ -786,7 +786,7 @@ PRAGMA user_version = 17;
|
|||
info!("database schema upgraded v16 -> v17");
|
||||
}
|
||||
Err(err) => {
|
||||
error!("update failed: {}", err);
|
||||
error!("update (v16->v17) failed: {}", err);
|
||||
panic!("database could not be upgraded");
|
||||
}
|
||||
}
|
||||
|
@ -833,7 +833,7 @@ PRAGMA user_version = 18;
|
|||
info!("database schema upgraded v17 -> v18");
|
||||
}
|
||||
Err(err) => {
|
||||
error!("update failed: {}", err);
|
||||
error!("update (v17->v18) failed: {}", err);
|
||||
panic!("database could not be upgraded");
|
||||
}
|
||||
}
|
||||
|
|
|
@ -30,6 +30,8 @@ use hyper::upgrade::Upgraded;
|
|||
use hyper::{
|
||||
header, server::conn::AddrStream, upgrade, Body, Request, Response, Server, StatusCode,
|
||||
};
|
||||
use nostr::key::FromPkStr;
|
||||
use nostr::key::Keys;
|
||||
use prometheus::IntCounterVec;
|
||||
use prometheus::IntGauge;
|
||||
use prometheus::{Encoder, Histogram, HistogramOpts, IntCounter, Opts, Registry, TextEncoder};
|
||||
|
@ -60,8 +62,6 @@ use tungstenite::error::Error as WsError;
|
|||
use tungstenite::handshake;
|
||||
use tungstenite::protocol::Message;
|
||||
use tungstenite::protocol::WebSocketConfig;
|
||||
use nostr::key::FromPkStr;
|
||||
use nostr::key::Keys;
|
||||
|
||||
/// Handle arbitrary HTTP requests, including for `WebSocket` upgrades.
|
||||
#[allow(clippy::too_many_arguments)]
|
||||
|
@ -653,6 +653,7 @@ fn get_header_string(header: &str, headers: &HeaderMap) -> Option<String> {
|
|||
async fn ctrl_c_or_signal(mut shutdown_signal: Receiver<()>) {
|
||||
let mut term_signal = tokio::signal::unix::signal(tokio::signal::unix::SignalKind::terminate())
|
||||
.expect("could not define signal");
|
||||
#[allow(clippy::never_loop)]
|
||||
loop {
|
||||
tokio::select! {
|
||||
_ = shutdown_signal.recv() => {
|
||||
|
@ -1029,25 +1030,23 @@ fn make_notice_message(notice: &Notice) -> Message {
|
|||
Message::text(json.to_string())
|
||||
}
|
||||
|
||||
fn allowed_to_send(event_str: &String, conn: &conn::ClientConn, settings: &Settings) -> bool {
|
||||
fn allowed_to_send(event_str: &str, conn: &conn::ClientConn, settings: &Settings) -> bool {
|
||||
// TODO: pass in kind so that we can avoid deserialization for most events
|
||||
if settings.authorization.nip42_dms {
|
||||
match serde_json::from_str::<Event>(event_str) {
|
||||
Ok(event) => {
|
||||
if event.kind == 4 {
|
||||
if event.kind == 4 || event.kind == 44 || event.kind == 1059 {
|
||||
match (conn.auth_pubkey(), event.tag_values_by_name("p").first()) {
|
||||
(Some(auth_pubkey), Some(recipient_pubkey)) => {
|
||||
recipient_pubkey == auth_pubkey || &event.pubkey == auth_pubkey
|
||||
},
|
||||
(_, _) => {
|
||||
false
|
||||
},
|
||||
}
|
||||
(_, _) => false,
|
||||
}
|
||||
} else {
|
||||
true
|
||||
}
|
||||
},
|
||||
Err(_) => false
|
||||
}
|
||||
Err(_) => false,
|
||||
}
|
||||
} else {
|
||||
true
|
||||
|
@ -1263,7 +1262,6 @@ async fn nostr_server(
|
|||
// handle each type of message
|
||||
let evid = ec.event_id().to_owned();
|
||||
let parsed : Result<EventWrapper> = Result::<EventWrapper>::from(ec);
|
||||
metrics.cmd_event.inc();
|
||||
match parsed {
|
||||
Ok(WrappedEvent(e)) => {
|
||||
metrics.cmd_event.inc();
|
||||
|
@ -1344,10 +1342,15 @@ async fn nostr_server(
|
|||
if conn.has_subscription(&s) {
|
||||
info!("client sent duplicate subscription, ignoring (cid: {}, sub: {:?})", cid, s.id);
|
||||
} else {
|
||||
metrics.cmd_req.inc();
|
||||
metrics.cmd_req.inc();
|
||||
if let Some(ref lim) = sub_lim_opt {
|
||||
lim.until_ready_with_jitter(jitter).await;
|
||||
}
|
||||
if settings.limits.limit_scrapers && s.is_scraper() {
|
||||
info!("subscription was scraper, ignoring (cid: {}, sub: {:?})", cid, s.id);
|
||||
ws_stream.send(Message::Text(format!("[\"EOSE\",\"{}\"]", s.id))).await.ok();
|
||||
continue
|
||||
}
|
||||
let (abandon_query_tx, abandon_query_rx) = oneshot::channel::<()>();
|
||||
match conn.subscribe(s.clone()) {
|
||||
Ok(()) => {
|
||||
|
@ -1371,7 +1374,7 @@ async fn nostr_server(
|
|||
// closing a request simply removes the subscription.
|
||||
let parsed : Result<Close> = Result::<Close>::from(cc);
|
||||
if let Ok(c) = parsed {
|
||||
metrics.cmd_close.inc();
|
||||
metrics.cmd_close.inc();
|
||||
// check if a query is currently
|
||||
// running, and remove it if so.
|
||||
let stop_tx = running_queries.remove(&c.id);
|
||||
|
|
|
@ -45,8 +45,8 @@ pub struct ReqFilter {
|
|||
|
||||
impl Serialize for ReqFilter {
|
||||
fn serialize<S>(&self, serializer: S) -> Result<S::Ok, S::Error>
|
||||
where
|
||||
S: Serializer,
|
||||
where
|
||||
S: Serializer,
|
||||
{
|
||||
let mut map = serializer.serialize_map(None)?;
|
||||
if let Some(ids) = &self.ids {
|
||||
|
@ -80,8 +80,8 @@ impl Serialize for ReqFilter {
|
|||
|
||||
impl<'de> Deserialize<'de> for ReqFilter {
|
||||
fn deserialize<D>(deserializer: D) -> Result<ReqFilter, D::Error>
|
||||
where
|
||||
D: Deserializer<'de>,
|
||||
where
|
||||
D: Deserializer<'de>,
|
||||
{
|
||||
let received: Value = Deserialize::deserialize(deserializer)?;
|
||||
let filter = received.as_object().ok_or_else(|| {
|
||||
|
@ -184,8 +184,8 @@ impl<'de> Deserialize<'de> for Subscription {
|
|||
/// Custom deserializer for subscriptions, which have a more
|
||||
/// complex structure than the other message types.
|
||||
fn deserialize<D>(deserializer: D) -> Result<Subscription, D::Error>
|
||||
where
|
||||
D: Deserializer<'de>,
|
||||
where
|
||||
D: Deserializer<'de>,
|
||||
{
|
||||
let mut v: Value = Deserialize::deserialize(deserializer)?;
|
||||
// this should be a 3-or-more element array.
|
||||
|
@ -258,6 +258,29 @@ impl Subscription {
|
|||
}
|
||||
false
|
||||
}
|
||||
|
||||
/// Is this subscription defined as a scraper query
|
||||
pub fn is_scraper(&self) -> bool {
|
||||
for f in &self.filters {
|
||||
let mut precision = 0;
|
||||
if f.ids.is_some() {
|
||||
precision += 2;
|
||||
}
|
||||
if f.authors.is_some() {
|
||||
precision += 1;
|
||||
}
|
||||
if f.kinds.is_some() {
|
||||
precision += 1;
|
||||
}
|
||||
if f.tags.is_some() {
|
||||
precision += 1;
|
||||
}
|
||||
if precision < 2 {
|
||||
return true;
|
||||
}
|
||||
}
|
||||
false
|
||||
}
|
||||
}
|
||||
|
||||
fn prefix_match(prefixes: &[String], target: &str) -> bool {
|
||||
|
@ -338,7 +361,7 @@ mod tests {
|
|||
let s: Subscription = serde_json::from_str(raw_json)?;
|
||||
assert_eq!(s.id, "some-id");
|
||||
assert_eq!(s.filters.len(), 1);
|
||||
assert_eq!(s.filters.get(0).unwrap().authors, None);
|
||||
assert_eq!(s.filters.first().unwrap().authors, None);
|
||||
Ok(())
|
||||
}
|
||||
|
||||
|
@ -402,7 +425,7 @@ mod tests {
|
|||
let s: Subscription = serde_json::from_str(raw_json)?;
|
||||
assert_eq!(s.id, "some-id");
|
||||
assert_eq!(s.filters.len(), 1);
|
||||
let first_filter = s.filters.get(0).unwrap();
|
||||
let first_filter = s.filters.first().unwrap();
|
||||
assert_eq!(
|
||||
first_filter.authors,
|
||||
Some(vec!("test-author-id".to_owned()))
|
||||
|
@ -633,11 +656,11 @@ mod tests {
|
|||
let s: Subscription = serde_json::from_str(
|
||||
r##"["REQ","xyz",{"authors":["abc", "bcd"], "since": 10, "until": 20, "limit":100, "#e": ["foo", "bar"], "#d": ["test"]}]"##,
|
||||
)?;
|
||||
let f = s.filters.get(0);
|
||||
let f = s.filters.first();
|
||||
let serialized = serde_json::to_string(&f)?;
|
||||
let serialized_wrapped = format!(r##"["REQ", "xyz",{}]"##, serialized);
|
||||
let parsed: Subscription = serde_json::from_str(&serialized_wrapped)?;
|
||||
let parsed_filter = parsed.filters.get(0);
|
||||
let parsed_filter = parsed.filters.first();
|
||||
if let Some(pf) = parsed_filter {
|
||||
assert_eq!(pf.since, Some(10));
|
||||
assert_eq!(pf.until, Some(20));
|
||||
|
@ -647,4 +670,14 @@ mod tests {
|
|||
}
|
||||
Ok(())
|
||||
}
|
||||
|
||||
#[test]
|
||||
fn is_scraper() -> Result<()> {
|
||||
assert!(serde_json::from_str::<Subscription>(r#"["REQ","some-id",{"kinds": [1984],"since": 123,"limit":1}]"#)?.is_scraper());
|
||||
assert!(serde_json::from_str::<Subscription>(r#"["REQ","some-id",{"kinds": [1984]},{"kinds": [1984],"authors":["aaaa"]}]"#)?.is_scraper());
|
||||
assert!(!serde_json::from_str::<Subscription>(r#"["REQ","some-id",{"kinds": [1984],"authors":["aaaa"]}]"#)?.is_scraper());
|
||||
assert!(!serde_json::from_str::<Subscription>(r#"["REQ","some-id",{"ids": ["aaaa"]}]"#)?.is_scraper());
|
||||
assert!(!serde_json::from_str::<Subscription>(r##"["REQ","some-id",{"#p": ["aaaa"],"kinds":[1,4]}]"##)?.is_scraper());
|
||||
Ok(())
|
||||
}
|
||||
}
|
||||
|
|
|
@ -37,7 +37,7 @@ pub fn is_lower_hex(s: &str) -> bool {
|
|||
})
|
||||
}
|
||||
|
||||
pub fn host_str(url: &String) -> Option<String> {
|
||||
pub fn host_str(url: &str) -> Option<String> {
|
||||
Url::parse(url)
|
||||
.ok()
|
||||
.and_then(|u| u.host_str().map(|s| s.to_string()))
|
||||
|
|
|
@ -103,8 +103,5 @@ fn get_available_port() -> Option<u16> {
|
|||
}
|
||||
pub fn port_is_available(port: u16) -> bool {
|
||||
info!("checking on port {}", port);
|
||||
match TcpListener::bind(("127.0.0.1", port)) {
|
||||
Ok(_) => true,
|
||||
Err(_) => false,
|
||||
}
|
||||
TcpListener::bind(("127.0.0.1", port)).is_ok()
|
||||
}
|
||||
|
|
|
@ -52,7 +52,7 @@ mod tests {
|
|||
let challenge = client_conn.auth_challenge().unwrap();
|
||||
let event = auth_event(challenge);
|
||||
|
||||
let result = client_conn.authenticate(&event, &RELAY.into());
|
||||
let result = client_conn.authenticate(&event, RELAY);
|
||||
|
||||
assert!(matches!(result, Ok(())));
|
||||
assert_eq!(client_conn.auth_challenge(), None);
|
||||
|
@ -67,7 +67,7 @@ mod tests {
|
|||
assert_eq!(client_conn.auth_pubkey(), None);
|
||||
|
||||
let event = auth_event(&"challenge".into());
|
||||
let result = client_conn.authenticate(&event, &RELAY.into());
|
||||
let result = client_conn.authenticate(&event, RELAY);
|
||||
|
||||
assert!(matches!(result, Err(Error::AuthFailure)));
|
||||
}
|
||||
|
@ -87,14 +87,14 @@ mod tests {
|
|||
let challenge = client_conn.auth_challenge().unwrap().clone();
|
||||
|
||||
let event = auth_event(&challenge);
|
||||
let result = client_conn.authenticate(&event, &RELAY.into());
|
||||
let result = client_conn.authenticate(&event, RELAY);
|
||||
|
||||
assert!(matches!(result, Ok(())));
|
||||
assert_eq!(client_conn.auth_challenge(), None);
|
||||
assert_eq!(client_conn.auth_pubkey(), Some(&event.pubkey));
|
||||
|
||||
let event1 = auth_event(&challenge);
|
||||
let result1 = client_conn.authenticate(&event1, &RELAY.into());
|
||||
let result1 = client_conn.authenticate(&event1, RELAY);
|
||||
|
||||
assert!(matches!(result1, Ok(())));
|
||||
assert_eq!(client_conn.auth_challenge(), None);
|
||||
|
@ -118,7 +118,7 @@ mod tests {
|
|||
let mut event = auth_event(challenge);
|
||||
event.sig = event.sig.chars().rev().collect::<String>();
|
||||
|
||||
let result = client_conn.authenticate(&event, &RELAY.into());
|
||||
let result = client_conn.authenticate(&event, RELAY);
|
||||
|
||||
assert!(matches!(result, Err(Error::AuthFailure)));
|
||||
}
|
||||
|
@ -138,7 +138,7 @@ mod tests {
|
|||
let challenge = client_conn.auth_challenge().unwrap();
|
||||
let event = auth_event_with_kind(challenge, 9999999999999999);
|
||||
|
||||
let result = client_conn.authenticate(&event, &RELAY.into());
|
||||
let result = client_conn.authenticate(&event, RELAY);
|
||||
|
||||
assert!(matches!(result, Err(Error::AuthFailure)));
|
||||
}
|
||||
|
@ -158,7 +158,7 @@ mod tests {
|
|||
let challenge = client_conn.auth_challenge().unwrap();
|
||||
let event = auth_event_with_created_at(challenge, unix_time() - 1200); // 20 minutes
|
||||
|
||||
let result = client_conn.authenticate(&event, &RELAY.into());
|
||||
let result = client_conn.authenticate(&event, RELAY);
|
||||
|
||||
assert!(matches!(result, Err(Error::AuthFailure)));
|
||||
}
|
||||
|
@ -178,7 +178,7 @@ mod tests {
|
|||
let challenge = client_conn.auth_challenge().unwrap();
|
||||
let event = auth_event_with_created_at(challenge, unix_time() + 1200); // 20 minutes
|
||||
|
||||
let result = client_conn.authenticate(&event, &RELAY.into());
|
||||
let result = client_conn.authenticate(&event, RELAY);
|
||||
|
||||
assert!(matches!(result, Err(Error::AuthFailure)));
|
||||
}
|
||||
|
@ -197,7 +197,7 @@ mod tests {
|
|||
|
||||
let event = auth_event_without_tags();
|
||||
|
||||
let result = client_conn.authenticate(&event, &RELAY.into());
|
||||
let result = client_conn.authenticate(&event, RELAY);
|
||||
|
||||
assert!(matches!(result, Err(Error::AuthFailure)));
|
||||
}
|
||||
|
@ -216,7 +216,7 @@ mod tests {
|
|||
|
||||
let event = auth_event_without_challenge();
|
||||
|
||||
let result = client_conn.authenticate(&event, &RELAY.into());
|
||||
let result = client_conn.authenticate(&event, RELAY);
|
||||
|
||||
assert!(matches!(result, Err(Error::AuthFailure)));
|
||||
}
|
||||
|
@ -236,7 +236,7 @@ mod tests {
|
|||
let challenge = client_conn.auth_challenge().unwrap();
|
||||
let event = auth_event_without_relay(challenge);
|
||||
|
||||
let result = client_conn.authenticate(&event, &RELAY.into());
|
||||
let result = client_conn.authenticate(&event, RELAY);
|
||||
|
||||
assert!(matches!(result, Err(Error::AuthFailure)));
|
||||
}
|
||||
|
@ -255,7 +255,7 @@ mod tests {
|
|||
|
||||
let event = auth_event(&"invalid challenge".into());
|
||||
|
||||
let result = client_conn.authenticate(&event, &RELAY.into());
|
||||
let result = client_conn.authenticate(&event, RELAY);
|
||||
|
||||
assert!(matches!(result, Err(Error::AuthFailure)));
|
||||
}
|
||||
|
@ -275,7 +275,7 @@ mod tests {
|
|||
let challenge = client_conn.auth_challenge().unwrap();
|
||||
let event = auth_event_with_relay(challenge, &"xyz".into());
|
||||
|
||||
let result = client_conn.authenticate(&event, &RELAY.into());
|
||||
let result = client_conn.authenticate(&event, RELAY);
|
||||
|
||||
assert!(matches!(result, Err(Error::AuthFailure)));
|
||||
}
|
||||
|
|
|
@ -73,7 +73,7 @@ async fn publish_test() -> Result<()> {
|
|||
let event_sub = r#"["REQ", "simple", {}]"#;
|
||||
sub_ws.send(event_sub.into()).await?;
|
||||
// read from subscription
|
||||
let ws_next = sub_ws.next().await;
|
||||
let _ws_next = sub_ws.next().await;
|
||||
let _res = relay.shutdown_tx.send(());
|
||||
Ok(())
|
||||
}
|
||||
|
|
Loading…
Reference in New Issue
Block a user